| Name | Valeric anhydride |
| Synonyms | Valeric anhydride VALERIC ANHYDRIDE pentanoic anhydride PENTANOIC ANHYDRIDE N-VALERIC ANHYDRIDE N-PENTANOIC ANHYDRIDE pentanoicacidanhydride Pentanoicacid,anhydride Pentanoic acid, anhydride Pentanoic acid, 1,1'-anhydride |
| CAS | 2082-59-9 |
| EINECS | 218-212-9 |
| InChI | InChI=1/C10H18O3/c1-3-5-7-9(11)13-10(12)8-6-4-2/h3-8H2,1-2H3 |
| InChIKey | DUCKXCGALKOSJF-UHFFFAOYSA-N |
| Molecular Formula | C10H18O3 |
| Molar Mass | 186.25 |
| Density | 0.944 g/mL at 20 °C (lit.) |
| Melting Point | -56 °C (lit.) |
| Boling Point | 228-230 °C (lit.) |
| Flash Point | 214°F |
| Solubility | Chloroform (Slightly), Methanol (Slightly) |
| Vapor Presure | 5Pa at 25℃ |
| Appearance | Liquid |
| Color | Clear colorless to yellow |
| BRN | 1770130 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Refractive Index | n20/D 1.421(lit.) |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | 34 - Causes burns |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) |
| UN IDs | UN 3265 8/PG 3 |
| WGK Germany | 3 |
| HS Code | 29159000 |
| Hazard Class | 8 |
| Packing Group | III |
| LogP | 3.33 at 25℃ |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |